C27H32ClFN4O4S2 — CID 118112292
5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl(methyl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118112292) has the molecular formula C27H32ClFN4O4S2 and a molecular weight of 595.16 g/mol. Its IUPAC name is 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl(methyl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl(methyl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118112292 |
| Molecular Formula | C27H32ClFN4O4S2 |
| Molecular Weight | 595.16 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl(methyl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)(=O)c2cc(Cl)c(N(C)C34CCCCN3CCC4)cc2F)c(OC)c1 |
| InChI | InChI=1S/C27H32ClFN4O4S2/c1-31(27-9-4-5-12-32(27)13-6-10-27)23-17-22(29)25(16-21(23)28)39(34,35)33(26-30-11-14-38-26)18-19-7-8-20(36-2)15-24(19)37-3/h7-8,11,14-17H,4-6,9-10,12-13,18H2,1-3H3 |
| InChIKey | IHUKHZWHFACRIO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.16 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |