C16H18ClFN4O2S2 — CID 163678723
5-chloro-2-fluoro-4-[(4-iminocyclohexyl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 163678723) has the molecular formula C16H18ClFN4O2S2 and a molecular weight of 416.93 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[(4-iminocyclohexyl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[(4-iminocyclohexyl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 163678723 |
| Molecular Formula | C16H18ClFN4O2S2 |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 5-chloro-2-fluoro-4-[(4-iminocyclohexyl)methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | [H]N=C1CCC(CNc2cc(F)c(S(=O)(=O)Nc3nccs3)cc2Cl)CC1 |
| InChI | InChI=1S/C16H18ClFN4O2S2/c17-12-7-15(26(23,24)22-16-20-5-6-25-16)13(18)8-14(12)21-9-10-1-3-11(19)4-2-10/h5-8,10,19,21H,1-4,9H2,(H,20,22)/b19-11- |
| InChIKey | JIZNXYFQFVYKDZ-ODLFYWEKSA-N |
| XLogP | 4.36 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|