C20H29ClFN5O2S2 — CID 134523080
5-chloro-2-fluoro-4-[5-(piperidin-3-ylmethylamino)pentylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134523080) has the molecular formula C20H29ClFN5O2S2 and a molecular weight of 490.07 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[5-(piperidin-3-ylmethylamino)pentylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[5-(piperidin-3-ylmethylamino)pentylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134523080 |
| Molecular Formula | C20H29ClFN5O2S2 |
| Molecular Weight | 490.07 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 5-chloro-2-fluoro-4-[5-(piperidin-3-ylmethylamino)pentylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1cc(Cl)c(NCCCCCNCC2CCCNC2)cc1F |
| InChI | InChI=1S/C20H29ClFN5O2S2/c21-16-11-19(31(28,29)27-20-26-9-10-30-20)17(22)12-18(16)25-8-3-1-2-6-23-13-15-5-4-7-24-14-15/h9-12,15,23-25H,1-8,13-14H2,(H,26,27) |
| InChIKey | IXHBDOCGMHEJQC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.07 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|