C17H23ClFN5O2S2 — CID 129251785
5-chloro-2-fluoro-4-[4-[[(3S)-pyrrolidin-3-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 129251785) has the molecular formula C17H23ClFN5O2S2 and a molecular weight of 447.99 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[4-[[(3S)-pyrrolidin-3-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[4-[[(3S)-pyrrolidin-3-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 129251785 |
| Molecular Formula | C17H23ClFN5O2S2 |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 5-chloro-2-fluoro-4-[4-[[(3S)-pyrrolidin-3-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1cc(Cl)c(NCCCCN[C@H]2CCNC2)cc1F |
| InChI | InChI=1S/C17H23ClFN5O2S2/c18-13-9-16(28(25,26)24-17-23-7-8-27-17)14(19)10-15(13)22-5-2-1-4-21-12-3-6-20-11-12/h7-10,12,20-22H,1-6,11H2,(H,23,24)/t12-/m0/s1 |
| InChIKey | HPFLVLMSTDQGJM-LBPRGKRZSA-N |
| XLogP | 2.88 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|