C20H29ClFN5S2 — CID 134536330
N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-N-(piperidin-3-ylmethyl)pentane-1,5-diamine (PubChem CID 134536330) has the molecular formula C20H29ClFN5S2 and a molecular weight of 458.07 g/mol. Its IUPAC name is N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-N-(piperidin-3-ylmethyl)pentane-1,5-diamine.
| Compound Name | N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-N-(piperidin-3-ylmethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 134536330 |
| Molecular Formula | C20H29ClFN5S2 |
| Molecular Weight | 458.07 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N'-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylamino)sulfanylphenyl]-N-(piperidin-3-ylmethyl)pentane-1,5-diamine |
| SMILES | Fc1cc(NCCCCCNCC2CCCNC2)c(Cl)cc1SNc1nccs1 |
| InChI | InChI=1S/C20H29ClFN5S2/c21-16-11-19(29-27-20-26-9-10-28-20)17(22)12-18(16)25-8-3-1-2-6-23-13-15-5-4-7-24-14-15/h9-12,15,23-25H,1-8,13-14H2,(H,26,27) |
| InChIKey | AHVXOJOYVJGWKB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.07 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|