C18H24ClF2N5OS2 — CID 155072624
(3R)-3-[[4-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylanilino]butylamino]methyl]pyrrolidin-3-ol (PubChem CID 155072624) has the molecular formula C18H24ClF2N5OS2 and a molecular weight of 464.01 g/mol. Its IUPAC name is (3R)-3-[[4-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylanilino]butylamino]methyl]pyrrolidin-3-ol.
| Compound Name | (3R)-3-[[4-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylanilino]butylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 155072624 |
| Molecular Formula | C18H24ClF2N5OS2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | (3R)-3-[[4-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylanilino]butylamino]methyl]pyrrolidin-3-ol |
| SMILES | O[C@]1(CNCCCCNc2cc(F)c(SNc3ncc(F)s3)cc2Cl)CCNC1 |
| InChI | InChI=1S/C18H24ClF2N5OS2/c19-12-7-15(29-26-17-25-9-16(21)28-17)13(20)8-14(12)24-5-2-1-4-22-10-18(27)3-6-23-11-18/h7-9,22-24,27H,1-6,10-11H2,(H,25,26)/t18-/m0/s1 |
| InChIKey | CLXAWXCMKBAFIV-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|