C18H26ClF2N5S2 — CID 145336091
N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-[2-(propylamino)ethyl]butane-1,4-diamine (PubChem CID 145336091) has the molecular formula C18H26ClF2N5S2 and a molecular weight of 450.02 g/mol. Its IUPAC name is N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-[2-(propylamino)ethyl]butane-1,4-diamine.
| Compound Name | N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-[2-(propylamino)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 145336091 |
| Molecular Formula | C18H26ClF2N5S2 |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-[2-(propylamino)ethyl]butane-1,4-diamine |
| SMILES | CCCNCCNCCCCNc1cc(F)c(SNc2ncc(F)s2)cc1Cl |
| InChI | InChI=1S/C18H26ClF2N5S2/c1-2-5-22-8-9-23-6-3-4-7-24-15-11-14(20)16(10-13(15)19)28-26-18-25-12-17(21)27-18/h10-12,22-24H,2-9H2,1H3,(H,25,26) |
| InChIKey | FYDVWDXHGMDONN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|