C18H26ClF2N5OS2 — CID 129258073
(3R)-1-N-[4-[2-chloro-5-fluoro-4-[[(5-fluoro-1,3-thiazol-2-yl)amino]methylsulfinyl]anilino]butyl]butane-1,3-diamine (PubChem CID 129258073) has the molecular formula C18H26ClF2N5OS2 and a molecular weight of 466.02 g/mol. Its IUPAC name is (3R)-1-N-[4-[2-chloro-5-fluoro-4-[[(5-fluoro-1,3-thiazol-2-yl)amino]methylsulfinyl]anilino]butyl]butane-1,3-diamine.
| Compound Name | (3R)-1-N-[4-[2-chloro-5-fluoro-4-[[(5-fluoro-1,3-thiazol-2-yl)amino]methylsulfinyl]anilino]butyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 129258073 |
| Molecular Formula | C18H26ClF2N5OS2 |
| Molecular Weight | 466.02 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (3R)-1-N-[4-[2-chloro-5-fluoro-4-[[(5-fluoro-1,3-thiazol-2-yl)amino]methylsulfinyl]anilino]butyl]butane-1,3-diamine |
| SMILES | C[C@@H](N)CCNCCCCNc1cc(F)c(S(=O)CNc2ncc(F)s2)cc1Cl |
| InChI | InChI=1S/C18H26ClF2N5OS2/c1-12(22)4-7-23-5-2-3-6-24-15-9-14(20)16(8-13(15)19)29(27)11-26-18-25-10-17(21)28-18/h8-10,12,23-24H,2-7,11,22H2,1H3,(H,25,26)/t12-,29?/m1/s1 |
| InChIKey | AKKKJCNBOFVSFI-ICTCQJIBSA-N |
| XLogP | 3.77 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.02 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|