C18H23ClF2N4O2S2 — CID 145336079
5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 145336079) has the molecular formula C18H23ClF2N4O2S2 and a molecular weight of 464.99 g/mol. Its IUPAC name is 5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 145336079 |
| Molecular Formula | C18H23ClF2N4O2S2 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 5-chloro-4-[4-(cyclopentylamino)butylamino]-2-fluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncc(F)s1)c1cc(Cl)c(NCCCCNC2CCCC2)cc1F |
| InChI | InChI=1S/C18H23ClF2N4O2S2/c19-13-9-16(29(26,27)25-18-24-11-17(21)28-18)14(20)10-15(13)23-8-4-3-7-22-12-5-1-2-6-12/h9-12,22-23H,1-8H2,(H,24,25) |
| InChIKey | WDTRFZFWLAVCJN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|