C16H22ClFN6O2S2 — CID 129251826
4-[4-[[(2R)-azetidin-2-yl]methylamino]butylamino]-5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 129251826) has the molecular formula C16H22ClFN6O2S2 and a molecular weight of 448.98 g/mol. Its IUPAC name is 4-[4-[[(2R)-azetidin-2-yl]methylamino]butylamino]-5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-[4-[[(2R)-azetidin-2-yl]methylamino]butylamino]-5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 129251826 |
| Molecular Formula | C16H22ClFN6O2S2 |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 4-[4-[[(2R)-azetidin-2-yl]methylamino]butylamino]-5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cc(Cl)c(NCCCCNC[C@H]2CCN2)cc1F |
| InChI | InChI=1S/C16H22ClFN6O2S2/c17-12-7-15(28(25,26)24-16-22-10-23-27-16)13(18)8-14(12)21-5-2-1-4-19-9-11-3-6-20-11/h7-8,10-11,19-21H,1-6,9H2,(H,22,23,24)/t11-/m1/s1 |
| InChIKey | OZABZHBGDCSKIZ-LLVKDONJSA-N |
| XLogP | 2.28 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|