C12H15ClFN5O3S2 — CID 129258417
5-chloro-2-fluoro-4-[4-(hydroxyamino)butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 129258417) has the molecular formula C12H15ClFN5O3S2 and a molecular weight of 395.87 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[4-(hydroxyamino)butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[4-(hydroxyamino)butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 129258417 |
| Molecular Formula | C12H15ClFN5O3S2 |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 5-chloro-2-fluoro-4-[4-(hydroxyamino)butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cc(Cl)c(NCCCCNO)cc1F |
| InChI | InChI=1S/C12H15ClFN5O3S2/c13-8-5-11(24(21,22)19-12-16-7-18-23-12)9(14)6-10(8)15-3-1-2-4-17-20/h5-7,15,17,20H,1-4H2,(H,16,18,19) |
| InChIKey | CMVHDNGDDZGKNX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|