C16H22BrFN6O2S2 — CID 129251802
4-[4-[(1-aminocyclopropyl)-methylamino]butylamino]-5-bromo-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 129251802) has the molecular formula C16H22BrFN6O2S2 and a molecular weight of 493.43 g/mol. Its IUPAC name is 4-[4-[(1-aminocyclopropyl)-methylamino]butylamino]-5-bromo-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-[4-[(1-aminocyclopropyl)-methylamino]butylamino]-5-bromo-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 129251802 |
| Molecular Formula | C16H22BrFN6O2S2 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 4-[4-[(1-aminocyclopropyl)-methylamino]butylamino]-5-bromo-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | CN(CCCCNc1cc(F)c(S(=O)(=O)Nc2ncns2)cc1Br)C1(N)CC1 |
| InChI | InChI=1S/C16H22BrFN6O2S2/c1-24(16(19)4-5-16)7-3-2-6-20-13-9-12(18)14(8-11(13)17)28(25,26)23-15-21-10-22-27-15/h8-10,20H,2-7,19H2,1H3,(H,21,22,23) |
| InChIKey | UFESUJBJNBFFMD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|