C17H23BrFN5O3S2 — CID 152889703
5-bromo-2-fluoro-4-[6-(3-hydroxyazetidin-3-yl)hexylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 152889703) has the molecular formula C17H23BrFN5O3S2 and a molecular weight of 508.44 g/mol. Its IUPAC name is 5-bromo-2-fluoro-4-[6-(3-hydroxyazetidin-3-yl)hexylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-fluoro-4-[6-(3-hydroxyazetidin-3-yl)hexylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 152889703 |
| Molecular Formula | C17H23BrFN5O3S2 |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 5-bromo-2-fluoro-4-[6-(3-hydroxyazetidin-3-yl)hexylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cc(Br)c(NCCCCCCC2(O)CNC2)cc1F |
| InChI | InChI=1S/C17H23BrFN5O3S2/c18-12-7-15(29(26,27)24-16-22-11-23-28-16)13(19)8-14(12)21-6-4-2-1-3-5-17(25)9-20-10-17/h7-8,11,20-21,25H,1-6,9-10H2,(H,22,23,24) |
| InChIKey | UDFATUUCSHQEAO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|