C17H26ClFN6O2S2 — CID 129258459
5-chloro-2-fluoro-4-[4-[2-(propylamino)ethylamino]butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 129258459) has the molecular formula C17H26ClFN6O2S2 and a molecular weight of 465.02 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[4-[2-(propylamino)ethylamino]butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[4-[2-(propylamino)ethylamino]butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 129258459 |
| Molecular Formula | C17H26ClFN6O2S2 |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 5-chloro-2-fluoro-4-[4-[2-(propylamino)ethylamino]butylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | CCCNCCNCCCCNc1cc(F)c(S(=O)(=O)Nc2ncns2)cc1Cl |
| InChI | InChI=1S/C17H26ClFN6O2S2/c1-2-5-20-8-9-21-6-3-4-7-22-15-11-14(19)16(10-13(15)18)29(26,27)25-17-23-12-24-28-17/h10-12,20-22H,2-9H2,1H3,(H,23,24,25) |
| InChIKey | RWJLSRIYQACQDX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|