C24H29ClFN5O3S2 — CID 134523374
5-chloro-2-fluoro-4-[4-[[(2S,4S)-4-phenoxypyrrolidin-2-yl]methylamino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134523374) has the molecular formula C24H29ClFN5O3S2 and a molecular weight of 554.11 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[4-[[(2S,4S)-4-phenoxypyrrolidin-2-yl]methylamino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[4-[[(2S,4S)-4-phenoxypyrrolidin-2-yl]methylamino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134523374 |
| Molecular Formula | C24H29ClFN5O3S2 |
| Molecular Weight | 554.11 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 5-chloro-2-fluoro-4-[4-[[(2S,4S)-4-phenoxypyrrolidin-2-yl]methylamino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1cc(Cl)c(NCCCCNC[C@@H]2C[C@H](Oc3ccccc3)CN2)cc1F |
| InChI | InChI=1S/C24H29ClFN5O3S2/c25-20-13-23(36(32,33)31-24-29-10-11-35-24)21(26)14-22(20)28-9-5-4-8-27-15-17-12-19(16-30-17)34-18-6-2-1-3-7-18/h1-3,6-7,10-11,13-14,17,19,27-28,30H,4-5,8-9,12,15-16H2,(H,29,31)/t17-,19-/m0/s1 |
| InChIKey | FAELEIXLVZZTHO-HKUYNNGSSA-N |
| XLogP | 4.33 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.11 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|