C20H27ClFN5O2S2 — CID 146572464
5-chloro-2-fluoro-4-[4-[[(1R,4R,5R,7S)-5-methyl-2-azabicyclo[2.2.1]heptan-7-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 146572464) has the molecular formula C20H27ClFN5O2S2 and a molecular weight of 488.05 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[4-[[(1R,4R,5R,7S)-5-methyl-2-azabicyclo[2.2.1]heptan-7-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[4-[[(1R,4R,5R,7S)-5-methyl-2-azabicyclo[2.2.1]heptan-7-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 146572464 |
| Molecular Formula | C20H27ClFN5O2S2 |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 5-chloro-2-fluoro-4-[4-[[(1R,4R,5R,7S)-5-methyl-2-azabicyclo[2.2.1]heptan-7-yl]amino]butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | C[C@@H]1C[C@H]2NC[C@@H]1[C@@H]2NCCCCNc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C20H27ClFN5O2S2/c1-12-8-17-19(13(12)11-26-17)24-5-3-2-4-23-16-10-15(22)18(9-14(16)21)31(28,29)27-20-25-6-7-30-20/h6-7,9-10,12-13,17,19,23-24,26H,2-5,8,11H2,1H3,(H,25,27)/t12-,13+,17-,19+/m1/s1 |
| InChIKey | RMQRQPCEXDWQHB-BXSJSEAGSA-N |
| XLogP | 3.51 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|