C19H27ClFN5O3S2 — CID 129243510
5-chloro-2-fluoro-4-[4-(6-hydroxy-6-methyl-1,4-diazepan-1-yl)butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 129243510) has the molecular formula C19H27ClFN5O3S2 and a molecular weight of 492.04 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[4-(6-hydroxy-6-methyl-1,4-diazepan-1-yl)butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[4-(6-hydroxy-6-methyl-1,4-diazepan-1-yl)butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 129243510 |
| Molecular Formula | C19H27ClFN5O3S2 |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 5-chloro-2-fluoro-4-[4-(6-hydroxy-6-methyl-1,4-diazepan-1-yl)butylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CC1(O)CNCCN(CCCCNc2cc(F)c(S(=O)(=O)Nc3nccs3)cc2Cl)C1 |
| InChI | InChI=1S/C19H27ClFN5O3S2/c1-19(27)12-22-5-8-26(13-19)7-3-2-4-23-16-11-15(21)17(10-14(16)20)31(28,29)25-18-24-6-9-30-18/h6,9-11,22-23,27H,2-5,7-8,12-13H2,1H3,(H,24,25) |
| InChIKey | PCIDHPKHKHVVLJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|