C17H24ClFN4O2S2 — CID 162073504
4-[[(6S)-7-amino-6-methylheptyl]amino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 162073504) has the molecular formula C17H24ClFN4O2S2 and a molecular weight of 434.99 g/mol. Its IUPAC name is 4-[[(6S)-7-amino-6-methylheptyl]amino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(6S)-7-amino-6-methylheptyl]amino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 162073504 |
| Molecular Formula | C17H24ClFN4O2S2 |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-[[(6S)-7-amino-6-methylheptyl]amino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | C[C@H](CN)CCCCCNc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C17H24ClFN4O2S2/c1-12(11-20)5-3-2-4-6-21-15-10-14(19)16(9-13(15)18)27(24,25)23-17-22-7-8-26-17/h7-10,12,21H,2-6,11,20H2,1H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | ZBKBRGCMTGRMDI-LBPRGKRZSA-N |
| XLogP | 4.30 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|