C24H30ClF3N4O5S2 — CID 162263618
tert-butyl (2S)-2-[6-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]hexanoyl]-4,4-difluoropyrrolidine-1-carboxylate (PubChem CID 162263618) has the molecular formula C24H30ClF3N4O5S2 and a molecular weight of 611.11 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]hexanoyl]-4,4-difluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[6-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]hexanoyl]-4,4-difluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162263618 |
| Molecular Formula | C24H30ClF3N4O5S2 |
| Molecular Weight | 611.11 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | tert-butyl (2S)-2-[6-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]hexanoyl]-4,4-difluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)C[C@H]1C(=O)CCCCCNc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C24H30ClF3N4O5S2/c1-23(2,3)37-22(34)32-14-24(27,28)13-18(32)19(33)7-5-4-6-8-29-17-12-16(26)20(11-15(17)25)39(35,36)31-21-30-9-10-38-21/h9-12,18,29H,4-8,13-14H2,1-3H3,(H,30,31)/t18-/m0/s1 |
| InChIKey | OTTJXYPHEBYDIZ-SFHVURJKSA-N |
| XLogP | 5.92 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.11 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|