C19H22ClF4N5O3S2 — CID 129257897
(2S,4S)-N-[4-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]butyl]-4-(trifluoromethyl)pyrrolidine-2-carboxamide (PubChem CID 129257897) has the molecular formula C19H22ClF4N5O3S2 and a molecular weight of 544.00 g/mol. Its IUPAC name is (2S,4S)-N-[4-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]butyl]-4-(trifluoromethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[4-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]butyl]-4-(trifluoromethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129257897 |
| Molecular Formula | C19H22ClF4N5O3S2 |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | (2S,4S)-N-[4-[2-chloro-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]butyl]-4-(trifluoromethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCCNc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Cl)[C@@H]1C[C@H](C(F)(F)F)CN1 |
| InChI | InChI=1S/C19H22ClF4N5O3S2/c20-12-8-16(34(31,32)29-18-27-5-6-33-18)13(21)9-14(12)25-3-1-2-4-26-17(30)15-7-11(10-28-15)19(22,23)24/h5-6,8-9,11,15,25,28H,1-4,7,10H2,(H,26,30)(H,27,29)/t11-,15-/m0/s1 |
| InChIKey | VHSGPQXVWWNPFE-NHYWBVRUSA-N |
| XLogP | 3.59 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|