C18H25ClFN5O2S2 — CID 134523842
4-[4-[(3R)-3-aminopiperidin-1-yl]butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134523842) has the molecular formula C18H25ClFN5O2S2 and a molecular weight of 462.02 g/mol. Its IUPAC name is 4-[4-[(3R)-3-aminopiperidin-1-yl]butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[4-[(3R)-3-aminopiperidin-1-yl]butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134523842 |
| Molecular Formula | C18H25ClFN5O2S2 |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-[4-[(3R)-3-aminopiperidin-1-yl]butylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N[C@@H]1CCCN(CCCCNc2cc(F)c(S(=O)(=O)Nc3nccs3)cc2Cl)C1 |
| InChI | InChI=1S/C18H25ClFN5O2S2/c19-14-10-17(29(26,27)24-18-23-6-9-28-18)15(20)11-16(14)22-5-1-2-7-25-8-3-4-13(21)12-25/h6,9-11,13,22H,1-5,7-8,12,21H2,(H,23,24)/t13-/m1/s1 |
| InChIKey | GUIILEOCFFZAFY-CYBMUJFWSA-N |
| XLogP | 3.35 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|