C18H22ClFN4O2S2 — CID 118109061
4-[[(8S)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109061) has the molecular formula C18H22ClFN4O2S2 and a molecular weight of 444.99 g/mol. Its IUPAC name is 4-[[(8S)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(8S)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109061 |
| Molecular Formula | C18H22ClFN4O2S2 |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 4-[[(8S)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methylamino]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1cc(Cl)c(NC[C@@H]2CCCN3CCCC23)cc1F |
| InChI | InChI=1S/C18H22ClFN4O2S2/c19-13-9-17(28(25,26)23-18-21-5-8-27-18)14(20)10-15(13)22-11-12-3-1-6-24-7-2-4-16(12)24/h5,8-10,12,16,22H,1-4,6-7,11H2,(H,21,23)/t12-,16?/m0/s1 |
| InChIKey | DIGWJYDIYHVKSX-HKALDPMFSA-N |
| XLogP | 4.02 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |