C19H28ClF2N5S2 — CID 129258463
N-[2-(butylamino)ethyl]-N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]butane-1,4-diamine (PubChem CID 129258463) has the molecular formula C19H28ClF2N5S2 and a molecular weight of 464.05 g/mol. Its IUPAC name is N-[2-(butylamino)ethyl]-N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]butane-1,4-diamine.
| Compound Name | N-[2-(butylamino)ethyl]-N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 129258463 |
| Molecular Formula | C19H28ClF2N5S2 |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[2-(butylamino)ethyl]-N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]butane-1,4-diamine |
| SMILES | CCCCNCCNCCCCNc1cc(F)c(SNc2ncc(F)s2)cc1Cl |
| InChI | InChI=1S/C19H28ClF2N5S2/c1-2-3-6-23-9-10-24-7-4-5-8-25-16-12-15(21)17(11-14(16)20)29-27-19-26-13-18(22)28-19/h11-13,23-25H,2-10H2,1H3,(H,26,27) |
| InChIKey | YLAHMTNEXGRXGQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|