C17H23ClF2N4S2 — CID 170092464
N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-(2-methylpropyl)butane-1,4-diamine (PubChem CID 170092464) has the molecular formula C17H23ClF2N4S2 and a molecular weight of 420.98 g/mol. Its IUPAC name is N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-(2-methylpropyl)butane-1,4-diamine.
| Compound Name | N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-(2-methylpropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 170092464 |
| Molecular Formula | C17H23ClF2N4S2 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N'-[2-chloro-5-fluoro-4-[(5-fluoro-1,3-thiazol-2-yl)amino]sulfanylphenyl]-N-(2-methylpropyl)butane-1,4-diamine |
| SMILES | CC(C)CNCCCCNc1cc(F)c(SNc2ncc(F)s2)cc1Cl |
| InChI | InChI=1S/C17H23ClF2N4S2/c1-11(2)9-21-5-3-4-6-22-14-8-13(19)15(7-12(14)18)26-24-17-23-10-16(20)25-17/h7-8,10-11,21-22H,3-6,9H2,1-2H3,(H,23,24) |
| InChIKey | SZHQSDAVLKRVJJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|