C14H15ClFN3O2S2 — CID 166786014
N-[5-chloro-4-(1,4-dioxan-2-ylmethylamino)-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 166786014) has the molecular formula C14H15ClFN3O2S2 and a molecular weight of 375.88 g/mol. Its IUPAC name is N-[5-chloro-4-(1,4-dioxan-2-ylmethylamino)-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-[5-chloro-4-(1,4-dioxan-2-ylmethylamino)-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 166786014 |
| Molecular Formula | C14H15ClFN3O2S2 |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-[5-chloro-4-(1,4-dioxan-2-ylmethylamino)-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | Fc1cc(NCC2COCCO2)c(Cl)cc1SNc1nccs1 |
| InChI | InChI=1S/C14H15ClFN3O2S2/c15-10-5-13(23-19-14-17-1-4-22-14)11(16)6-12(10)18-7-9-8-20-2-3-21-9/h1,4-6,9,18H,2-3,7-8H2,(H,17,19) |
| InChIKey | AGWNBSXWHBPHQT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|