About N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine
N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 134602301) has the molecular formula C16H10ClF3N2OS2
and a molecular weight of 402.85 g/mol. Its IUPAC name is N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
| PubChem CID | 134602301 |
| Molecular Formula | C16H10ClF3N2OS2 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | Fc1cc(OCc2c(F)cccc2F)c(Cl)cc1SNc1nccs1 |
| InChI | InChI=1S/C16H10ClF3N2OS2/c17-10-6-15(25-22-16-21-4-5-24-16)13(20)7-14(10)23-8-9-11(18)2-1-3-12(9)19/h1-7H,8H2,(H,21,22) |
| InChIKey | IECGRINFMIDEKI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine?
The IUPAC name of N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine (CID 134602301) is N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine?
The canonical SMILES for N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine is Fc1cc(OCc2c(F)cccc2F)c(Cl)cc1SNc1nccs1.
What is the InChIKey of N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine?
The InChIKey is IECGRINFMIDEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClF3N2OS2/c17-10-6-15(25-22-16-21-4-5-24-16)13(20)7-14(10)23-8-9-11(18)2-1-3-12(9)19/h1-7H,8H2,(H,21,22).
What are the key properties of N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine?
N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine has a molecular weight of 402.85 g/mol, XLogP of 5.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine is sourced from PubChem (CID 134602301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).