C16H10ClF3N2OS2 — CID 134602301
N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine (PubChem CID 134602301) has the molecular formula C16H10ClF3N2OS2 and a molecular weight of 402.85 g/mol. Its IUPAC name is N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine.
| Compound Name | N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134602301 |
| Molecular Formula | C16H10ClF3N2OS2 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | N-[5-chloro-4-[(2,6-difluorophenyl)methoxy]-2-fluorophenyl]sulfanyl-1,3-thiazol-2-amine |
| SMILES | Fc1cc(OCc2c(F)cccc2F)c(Cl)cc1SNc1nccs1 |
| InChI | InChI=1S/C16H10ClF3N2OS2/c17-10-6-15(25-22-16-21-4-5-24-16)13(20)7-14(10)23-8-9-11(18)2-1-3-12(9)19/h1-7H,8H2,(H,21,22) |
| InChIKey | IECGRINFMIDEKI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|