C16H11ClF2N2OS2 — CID 134602275
N-[5-chloro-2-fluoro-4-[(2-fluorophenyl)methoxy]phenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 134602275) has the molecular formula C16H11ClF2N2OS2 and a molecular weight of 384.86 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-[(2-fluorophenyl)methoxy]phenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-[(2-fluorophenyl)methoxy]phenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 134602275 |
| Molecular Formula | C16H11ClF2N2OS2 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-[(2-fluorophenyl)methoxy]phenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | Fc1ccccc1COc1cc(F)c(SNc2cscn2)cc1Cl |
| InChI | InChI=1S/C16H11ClF2N2OS2/c17-11-5-15(24-21-16-8-23-9-20-16)13(19)6-14(11)22-7-10-3-1-2-4-12(10)18/h1-6,8-9,21H,7H2 |
| InChIKey | MNLVAUBZCWMCJQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|