C16H13ClFN3S2 — CID 134601976
N-[4-(benzylamino)-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 134601976) has the molecular formula C16H13ClFN3S2 and a molecular weight of 365.89 g/mol. Its IUPAC name is N-[4-(benzylamino)-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[4-(benzylamino)-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 134601976 |
| Molecular Formula | C16H13ClFN3S2 |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-[4-(benzylamino)-5-chloro-2-fluorophenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | Fc1cc(NCc2ccccc2)c(Cl)cc1SNc1cscn1 |
| InChI | InChI=1S/C16H13ClFN3S2/c17-12-6-15(23-21-16-9-22-10-20-16)13(18)7-14(12)19-8-11-4-2-1-3-5-11/h1-7,9-10,19,21H,8H2 |
| InChIKey | PXBHFTJVNSFDID-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|