C10H8ClFN2S — CID 107527417
2-chloro-5-fluoro-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 107527417) has the molecular formula C10H8ClFN2S and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-chloro-5-fluoro-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 107527417 |
| Molecular Formula | C10H8ClFN2S |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-chloro-5-fluoro-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Fc1ccc(Cl)c(NCc2cscn2)c1 |
| InChI | InChI=1S/C10H8ClFN2S/c11-9-2-1-7(12)3-10(9)13-4-8-5-15-6-14-8/h1-3,5-6,13H,4H2 |
| InChIKey | PYRWNXOSLFIBJQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |