C11H8ClN3S — CID 60721480
2-chloro-5-(1,3-thiazol-4-ylmethylamino)benzonitrile (PubChem CID 60721480) has the molecular formula C11H8ClN3S and a molecular weight of 249.73 g/mol. Its IUPAC name is 2-chloro-5-(1,3-thiazol-4-ylmethylamino)benzonitrile.
| Compound Name | 2-chloro-5-(1,3-thiazol-4-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 60721480 |
| Molecular Formula | C11H8ClN3S |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2-chloro-5-(1,3-thiazol-4-ylmethylamino)benzonitrile |
| SMILES | N#Cc1cc(NCc2cscn2)ccc1Cl |
| InChI | InChI=1S/C11H8ClN3S/c12-11-2-1-9(3-8(11)4-13)14-5-10-6-16-7-15-10/h1-3,6-7,14H,5H2 |
| InChIKey | LJWGAJGLEQRRDN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |