C12H10FN3S — CID 115367543
2-fluoro-4-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile (PubChem CID 115367543) has the molecular formula C12H10FN3S and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-fluoro-4-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile.
| Compound Name | 2-fluoro-4-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 115367543 |
| Molecular Formula | C12H10FN3S |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-fluoro-4-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCc2cscn2)cc1F |
| InChI | InChI=1S/C12H10FN3S/c13-12-5-10(2-1-9(12)6-14)15-4-3-11-7-17-8-16-11/h1-2,5,7-8,15H,3-4H2 |
| InChIKey | TZDDAZZSUJLBPD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |