C13H13N3S — CID 107106915
3-methyl-2-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile (PubChem CID 107106915) has the molecular formula C13H13N3S and a molecular weight of 243.34 g/mol. Its IUPAC name is 3-methyl-2-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile.
| Compound Name | 3-methyl-2-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 107106915 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 3-methyl-2-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile |
| SMILES | Cc1cccc(C#N)c1NCCc1cscn1 |
| InChI | InChI=1S/C13H13N3S/c1-10-3-2-4-11(7-14)13(10)15-6-5-12-8-17-9-16-12/h2-4,8-9,15H,5-6H2,1H3 |
| InChIKey | MEHYYLBBHZBCCQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |