C12H12N4S — CID 115499504
2-amino-5-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile (PubChem CID 115499504) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-amino-5-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile.
| Compound Name | 2-amino-5-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 115499504 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-amino-5-[2-(1,3-thiazol-4-yl)ethylamino]benzonitrile |
| SMILES | N#Cc1cc(NCCc2cscn2)ccc1N |
| InChI | InChI=1S/C12H12N4S/c13-6-9-5-10(1-2-12(9)14)15-4-3-11-7-17-8-16-11/h1-2,5,7-8,15H,3-4,14H2 |
| InChIKey | BARFWWMYJVLDMW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|