C11H7FN2OS — CID 78952690
2-fluoro-4-(1,3-thiazol-4-ylmethoxy)benzonitrile (PubChem CID 78952690) has the molecular formula C11H7FN2OS and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-fluoro-4-(1,3-thiazol-4-ylmethoxy)benzonitrile.
| Compound Name | 2-fluoro-4-(1,3-thiazol-4-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 78952690 |
| Molecular Formula | C11H7FN2OS |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-fluoro-4-(1,3-thiazol-4-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCc2cscn2)cc1F |
| InChI | InChI=1S/C11H7FN2OS/c12-11-3-10(2-1-8(11)4-13)15-5-9-6-16-7-14-9/h1-3,6-7H,5H2 |
| InChIKey | XLRCXORCOJPEKJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |