C15H13FN2O3 — CID 103174663
4-[(3,4-dimethoxy-2-pyridinyl)methoxy]-2-fluorobenzonitrile (PubChem CID 103174663) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-[(3,4-dimethoxy-2-pyridinyl)methoxy]-2-fluorobenzonitrile.
| Compound Name | 4-[(3,4-dimethoxy-2-pyridinyl)methoxy]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103174663 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-[(3,4-dimethoxy-2-pyridinyl)methoxy]-2-fluorobenzonitrile |
| SMILES | COc1ccnc(COc2ccc(C#N)c(F)c2)c1OC |
| InChI | InChI=1S/C15H13FN2O3/c1-19-14-5-6-18-13(15(14)20-2)9-21-11-4-3-10(8-17)12(16)7-11/h3-7H,9H2,1-2H3 |
| InChIKey | BTJLWHRPKSKNHX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |