C15H15N3O2 — CID 103172165
2-[(3,4-dimethoxy-2-pyridinyl)methylamino]benzonitrile (PubChem CID 103172165) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[(3,4-dimethoxy-2-pyridinyl)methylamino]benzonitrile.
| Compound Name | 2-[(3,4-dimethoxy-2-pyridinyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 103172165 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[(3,4-dimethoxy-2-pyridinyl)methylamino]benzonitrile |
| SMILES | COc1ccnc(CNc2ccccc2C#N)c1OC |
| InChI | InChI=1S/C15H15N3O2/c1-19-14-7-8-17-13(15(14)20-2)10-18-12-6-4-3-5-11(12)9-16/h3-8,18H,10H2,1-2H3 |
| InChIKey | ASAZEOILRPFNRD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |