C14H14BrClN2O2 — CID 103478939
2-bromo-3-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline (PubChem CID 103478939) has the molecular formula C14H14BrClN2O2 and a molecular weight of 357.64 g/mol. Its IUPAC name is 2-bromo-3-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline.
| Compound Name | 2-bromo-3-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 103478939 |
| Molecular Formula | C14H14BrClN2O2 |
| Molecular Weight | 357.64 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 2-bromo-3-chloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline |
| SMILES | COc1ccnc(CNc2cccc(Cl)c2Br)c1OC |
| InChI | InChI=1S/C14H14BrClN2O2/c1-19-12-6-7-17-11(14(12)20-2)8-18-10-5-3-4-9(16)13(10)15/h3-7,18H,8H2,1-2H3 |
| InChIKey | HJKVHEHCHALRCJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |