C14H16N2O2 — CID 103172115
N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline (PubChem CID 103172115) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline.
| Compound Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 103172115 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline |
| SMILES | COc1ccnc(CNc2ccccc2)c1OC |
| InChI | InChI=1S/C14H16N2O2/c1-17-13-8-9-15-12(14(13)18-2)10-16-11-6-4-3-5-7-11/h3-9,16H,10H2,1-2H3 |
| InChIKey | QCJNFFJMKDPOBK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |