C9H14N2O3 — CID 103172527
1-(3,4-dimethoxy-2-pyridinyl)-N-methoxymethanamine (PubChem CID 103172527) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(3,4-dimethoxy-2-pyridinyl)-N-methoxymethanamine.
| Compound Name | 1-(3,4-dimethoxy-2-pyridinyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 103172527 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(3,4-dimethoxy-2-pyridinyl)-N-methoxymethanamine |
| SMILES | CONCc1nccc(OC)c1OC |
| InChI | InChI=1S/C9H14N2O3/c1-12-8-4-5-10-7(6-11-14-3)9(8)13-2/h4-5,11H,6H2,1-3H3 |
| InChIKey | NVPFNYHXKNXYFF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|