C12H18N2O2 — CID 103172790
N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-methylprop-2-en-1-amine (PubChem CID 103172790) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-methylprop-2-en-1-amine.
| Compound Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103172790 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CNCc1nccc(OC)c1OC |
| InChI | InChI=1S/C12H18N2O2/c1-9(2)7-13-8-10-12(16-4)11(15-3)5-6-14-10/h5-6,13H,1,7-8H2,2-4H3 |
| InChIKey | HGWKQDBTEVQFKH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|