C16H20N2O2S — CID 103172287
N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-phenylsulfanylethanamine (PubChem CID 103172287) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-phenylsulfanylethanamine.
| Compound Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-phenylsulfanylethanamine |
|---|---|
| PubChem CID | 103172287 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-phenylsulfanylethanamine |
| SMILES | COc1ccnc(CNCCSc2ccccc2)c1OC |
| InChI | InChI=1S/C16H20N2O2S/c1-19-15-8-9-18-14(16(15)20-2)12-17-10-11-21-13-6-4-3-5-7-13/h3-9,17H,10-12H2,1-2H3 |
| InChIKey | GEPAJIHJQSHKBJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|