C8H10ClNO2 — CID 5079722
2-(chloromethyl)-3,4-dimethoxypyridine (PubChem CID 5079722) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is 2-(chloromethyl)-3,4-dimethoxypyridine.
| Compound Name | 2-(chloromethyl)-3,4-dimethoxypyridine |
|---|---|
| PubChem CID | 5079722 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-(chloromethyl)-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(CCl)c1OC |
| InChI | InChI=1S/C8H10ClNO2/c1-11-7-3-4-10-6(5-9)8(7)12-2/h3-4H,5H2,1-2H3 |
| InChIKey | ZWFCXDBCXGDDOM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|