C14H15NO2 — CID 141149610
2-benzyl-3,4-dimethoxypyridine (PubChem CID 141149610) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-benzyl-3,4-dimethoxypyridine.
| Compound Name | 2-benzyl-3,4-dimethoxypyridine |
|---|---|
| PubChem CID | 141149610 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-benzyl-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(Cc2ccccc2)c1OC |
| InChI | InChI=1S/C14H15NO2/c1-16-13-8-9-15-12(14(13)17-2)10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | UBAQJDOLRXNDKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |