C16H21N3O2 — CID 103173297
2-[[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]methyl]aniline (PubChem CID 103173297) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]methyl]aniline.
| Compound Name | 2-[[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]methyl]aniline |
|---|---|
| PubChem CID | 103173297 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]methyl]aniline |
| SMILES | COc1ccnc(CN(C)Cc2ccccc2N)c1OC |
| InChI | InChI=1S/C16H21N3O2/c1-19(10-12-6-4-5-7-13(12)17)11-14-16(21-3)15(20-2)8-9-18-14/h4-9H,10-11,17H2,1-3H3 |
| InChIKey | CNBIHESEWCQYRX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|