C14H14BrNO3 — CID 103172955
2-[(2-bromophenoxy)methyl]-3,4-dimethoxypyridine (PubChem CID 103172955) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-[(2-bromophenoxy)methyl]-3,4-dimethoxypyridine.
| Compound Name | 2-[(2-bromophenoxy)methyl]-3,4-dimethoxypyridine |
|---|---|
| PubChem CID | 103172955 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-[(2-bromophenoxy)methyl]-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(COc2ccccc2Br)c1OC |
| InChI | InChI=1S/C14H14BrNO3/c1-17-13-7-8-16-11(14(13)18-2)9-19-12-6-4-3-5-10(12)15/h3-8H,9H2,1-2H3 |
| InChIKey | OOUQGSMIRSINIX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |