C15H15BrFNO3 — CID 107691675
2-[[4-(bromomethyl)-2-fluorophenoxy]methyl]-3,4-dimethoxypyridine (PubChem CID 107691675) has the molecular formula C15H15BrFNO3 and a molecular weight of 356.19 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)-2-fluorophenoxy]methyl]-3,4-dimethoxypyridine.
| Compound Name | 2-[[4-(bromomethyl)-2-fluorophenoxy]methyl]-3,4-dimethoxypyridine |
|---|---|
| PubChem CID | 107691675 |
| Molecular Formula | C15H15BrFNO3 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-[[4-(bromomethyl)-2-fluorophenoxy]methyl]-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(COc2ccc(CBr)cc2F)c1OC |
| InChI | InChI=1S/C15H15BrFNO3/c1-19-14-5-6-18-12(15(14)20-2)9-21-13-4-3-10(8-16)7-11(13)17/h3-7H,8-9H2,1-2H3 |
| InChIKey | KACNJWKJWIMLDX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|