C17H21NO3 — CID 103174172
3,4-dimethoxy-2-[(2-propan-2-ylphenoxy)methyl]pyridine (PubChem CID 103174172) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3,4-dimethoxy-2-[(2-propan-2-ylphenoxy)methyl]pyridine.
| Compound Name | 3,4-dimethoxy-2-[(2-propan-2-ylphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 103174172 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3,4-dimethoxy-2-[(2-propan-2-ylphenoxy)methyl]pyridine |
| SMILES | COc1ccnc(COc2ccccc2C(C)C)c1OC |
| InChI | InChI=1S/C17H21NO3/c1-12(2)13-7-5-6-8-15(13)21-11-14-17(20-4)16(19-3)9-10-18-14/h5-10,12H,11H2,1-4H3 |
| InChIKey | NRRFDELRZNSSJJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |