C18H17NO3 — CID 101394802
4-(isoquinolin-1-ylmethyl)-2,6-dimethoxyphenol (PubChem CID 101394802) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-(isoquinolin-1-ylmethyl)-2,6-dimethoxyphenol.
| Compound Name | 4-(isoquinolin-1-ylmethyl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 101394802 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-(isoquinolin-1-ylmethyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(Cc2nccc3ccccc23)cc(OC)c1O |
| InChI | InChI=1S/C18H17NO3/c1-21-16-10-12(11-17(22-2)18(16)20)9-15-14-6-4-3-5-13(14)7-8-19-15/h3-8,10-11,20H,9H2,1-2H3 |
| InChIKey | ZYMFWIQDLPARNM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |