C19H17NO4 — CID 102334723
isoquinolin-1-yl-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 102334723) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is isoquinolin-1-yl-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | isoquinolin-1-yl-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 102334723 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | isoquinolin-1-yl-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2nccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H17NO4/c1-22-15-10-13(11-16(23-2)19(15)24-3)18(21)17-14-7-5-4-6-12(14)8-9-20-17/h4-11H,1-3H3 |
| InChIKey | PVOGHSOCLQQWMT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |