C23H26N2O5 — CID 141466056
[3-(3-methylbutoxy)quinoxalin-2-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 141466056) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [3-(3-methylbutoxy)quinoxalin-2-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [3-(3-methylbutoxy)quinoxalin-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 141466056 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [3-(3-methylbutoxy)quinoxalin-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2nc3ccccc3nc2OCCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C23H26N2O5/c1-14(2)10-11-30-23-20(24-16-8-6-7-9-17(16)25-23)21(26)15-12-18(27-3)22(29-5)19(13-15)28-4/h6-9,12-14H,10-11H2,1-5H3 |
| InChIKey | IYFVJLJQQDWICF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |